[(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16S,17R,18R,19S,22S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate
Internal ID | 4975eb89-a2af-454a-9e0f-b44ead4cb047 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16S,17R,18R,19S,22S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(C(C6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(CC)O)O)C)OC(=O)C)OC(=O)C)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H]([C@@H]([C@H]6[C@]7([C@]5(C4)OC6([C@H](CC7)OC(=O)[C@](C)(CC)O)O)C)OC(=O)C)OC(=O)C)O)O |
InChI | InChI=1S/C41H63NO14/c1-10-20(4)34(46)55-33-28(45)27-23(18-42-17-19(3)12-13-25(42)38(27,9)49)24-16-39-32(40(24,33)50)30(53-22(6)44)29(52-21(5)43)31-36(39,7)15-14-26(41(31,51)56-39)54-35(47)37(8,48)11-2/h19-20,23-33,45,48-51H,10-18H2,1-9H3/t19-,20+,23-,24-,25-,26-,27+,28+,29-,30+,31-,32+,33-,36-,37-,38+,39+,40-,41?/m0/s1 |
InChI Key | HYTGGNIMZXFORS-KSUKFXFZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H63NO14 |
Molecular Weight | 793.90 g/mol |
Exact Mass | 793.42485568 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 2.10 |
Atomic LogP (AlogP) | 1.61 |
H-Bond Acceptor | 15 |
H-Bond Donor | 5 |
Rotatable Bonds | 8 |
143-57-7 |
C41-H63-N-O14 |
1,3-BENZENEDISULFONYLCHLORIDE |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16S,17R,18R,19S,22S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16S,17R,18R,19S,22S,25R)-16,17-diacetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/07/13-benzenedisulfonylchloride.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6715 | 67.15% |
Caco-2 | - | 0.8611 | 86.11% |
Blood Brain Barrier | + | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Lysosomes | 0.6149 | 61.49% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.7846 | 78.46% |
P-glycoprotein inhibitior | + | 0.7658 | 76.58% |
P-glycoprotein substrate | + | 0.6820 | 68.20% |
CYP3A4 substrate | + | 0.7406 | 74.06% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7867 | 78.67% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9078 | 90.78% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9308 | 93.08% |
CYP1A2 inhibition | - | 0.9425 | 94.25% |
CYP2C8 inhibition | + | 0.7207 | 72.07% |
CYP inhibitory promiscuity | - | 0.9613 | 96.13% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5302 | 53.02% |
Eye corrosion | - | 0.9891 | 98.91% |
Eye irritation | - | 0.9078 | 90.78% |
Skin irritation | - | 0.7598 | 75.98% |
Skin corrosion | - | 0.9349 | 93.49% |
Ames mutagenesis | - | 0.6174 | 61.74% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5269 | 52.69% |
Micronuclear | + | 0.5500 | 55.00% |
Hepatotoxicity | + | 0.5666 | 56.66% |
skin sensitisation | - | 0.8817 | 88.17% |
Respiratory toxicity | + | 0.7000 | 70.00% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | + | 0.4536 | 45.36% |
Acute Oral Toxicity (c) | I | 0.8149 | 81.49% |
Estrogen receptor binding | + | 0.7279 | 72.79% |
Androgen receptor binding | + | 0.7616 | 76.16% |
Thyroid receptor binding | - | 0.5479 | 54.79% |
Glucocorticoid receptor binding | + | 0.7414 | 74.14% |
Aromatase binding | + | 0.6620 | 66.20% |
PPAR gamma | + | 0.7510 | 75.10% |
Honey bee toxicity | - | 0.6790 | 67.90% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.5700 | 57.00% |
Fish aquatic toxicity | + | 0.7302 | 73.02% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.95% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.16% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.57% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.22% | 85.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 97.54% | 89.05% |
CHEMBL2581 | P07339 | Cathepsin D | 95.10% | 98.95% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.34% | 95.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 92.09% | 87.16% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.91% | 97.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.50% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.29% | 96.47% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.20% | 95.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.01% | 95.89% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 90.68% | 82.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.58% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.17% | 94.45% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 90.16% | 97.28% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.81% | 86.33% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.69% | 82.69% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.07% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.35% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.70% | 93.56% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.22% | 89.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.71% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.23% | 92.50% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.16% | 94.78% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.16% | 99.17% |
CHEMBL299 | P17252 | Protein kinase C alpha | 86.16% | 98.03% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.50% | 91.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.89% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.73% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.64% | 96.90% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.40% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.34% | 97.09% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.14% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.89% | 89.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.72% | 94.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.60% | 97.29% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.23% | 93.04% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.84% | 98.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.78% | 92.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.70% | 91.11% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.67% | 99.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.42% | 95.50% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.38% | 95.71% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.36% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.28% | 94.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.19% | 93.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.00% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum nigrum |