(12R)-13-(3,5-dihydroxyphenyl)-12-hydroxytridecan-6-one
| Internal ID | 3f4a80c9-dd79-49c0-9154-3c4a1a86874c |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | (12R)-13-(3,5-dihydroxyphenyl)-12-hydroxytridecan-6-one |
| SMILES (Canonical) | CCCCCC(=O)CCCCCC(CC1=CC(=CC(=C1)O)O)O |
| SMILES (Isomeric) | CCCCCC(=O)CCCCC[C@H](CC1=CC(=CC(=C1)O)O)O |
| InChI | InChI=1S/C19H30O4/c1-2-3-5-8-16(20)9-6-4-7-10-17(21)11-15-12-18(22)14-19(23)13-15/h12-14,17,21-23H,2-11H2,1H3/t17-/m1/s1 |
| InChI Key | DDSBDDPAAWZCAL-QGZVFWFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.61% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.37% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.87% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.33% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.39% | 97.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.29% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.22% | 90.71% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.46% | 95.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.56% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.57% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.28% | 94.45% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.28% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.16% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ononis natrix |
| Ononis viscosa |
| PubChem | 101664468 |
| LOTUS | LTS0137414 |
| wikiData | Q104976785 |