(E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-[5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]prop-2-enamide
Internal ID | cb97de2d-e33e-489c-bcec-dfcede87967a |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-[5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]ethyl]prop-2-enamide |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)NCCC2=CNC3=C2C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)NCCC2=CNC3=C2C=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
InChI | InChI=1S/C26H30N2O9/c1-35-20-10-14(2-6-19(20)30)3-7-22(31)27-9-8-15-12-28-18-5-4-16(11-17(15)18)36-26-25(34)24(33)23(32)21(13-29)37-26/h2-7,10-12,21,23-26,28-30,32-34H,8-9,13H2,1H3,(H,27,31)/b7-3+/t21-,23-,24+,25-,26-/m1/s1 |
InChI Key | RZBNXMNICVMBNE-JWMPNCEXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H30N2O9 |
Molecular Weight | 514.50 g/mol |
Exact Mass | 514.19513054 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.96% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.27% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.21% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 94.52% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.17% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.60% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.90% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.15% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.01% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.90% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.00% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.24% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.57% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.84% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.59% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.41% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 83.82% | 98.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.52% | 94.33% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 82.78% | 98.59% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.22% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.92% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.05% | 86.92% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.59% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carthamus tinctorius |
PubChem | 101933130 |
LOTUS | LTS0142504 |
wikiData | Q105248305 |