1,2,3,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol
Internal ID | 284bfebf-ecc5-48da-b697-e68dbcd0c6fc |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 1,2,3,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol |
SMILES (Canonical) | COC1=C(C=C2CC3C4=C(CCN3)C(=C(C(=C4C2=C1)OC)OC)OC)O |
SMILES (Isomeric) | COC1=C(C=C2CC3C4=C(CCN3)C(=C(C(=C4C2=C1)OC)OC)OC)O |
InChI | InChI=1S/C20H23NO5/c1-23-15-9-12-10(8-14(15)22)7-13-16-11(5-6-21-13)18(24-2)20(26-4)19(25-3)17(12)16/h8-9,13,21-22H,5-7H2,1-4H3 |
InChI Key | HWDDNUKDQLZPKF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H23NO5 |
Molecular Weight | 357.40 g/mol |
Exact Mass | 357.15762283 g/mol |
Topological Polar Surface Area (TPSA) | 69.20 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of 1,2,3,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol 2D Structure of 1,2,3,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/12310-tetramethoxy-566a7-tetrahydro-4h-dibenzodegquinolin-9-ol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.96% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.52% | 91.79% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.01% | 95.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.36% | 91.49% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.58% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.74% | 86.33% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.43% | 88.48% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.04% | 92.68% |
CHEMBL2535 | P11166 | Glucose transporter | 89.74% | 98.75% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.61% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.86% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.67% | 90.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 88.37% | 91.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.99% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.97% | 99.17% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.29% | 98.11% |
CHEMBL2581 | P07339 | Cathepsin D | 86.34% | 98.95% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.29% | 93.03% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.34% | 91.03% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 83.86% | 97.03% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.93% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.88% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.65% | 93.99% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 81.62% | 89.32% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 80.36% | 95.70% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.25% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.23% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xylopia parviflora |
PubChem | 162922313 |
LOTUS | LTS0099360 |
wikiData | Q105034610 |