12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-1,5-diol
| Internal ID | 2847fb9a-6ce4-4028-b829-8d977f57f923 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-1,5-diol |
| SMILES (Canonical) | CC(C)C1=C(C=C2CC3(CCCC(C3CCC2=C1)(C)C)O)O |
| SMILES (Isomeric) | CC(C)C1=C(C=C2CC3(CCCC(C3CCC2=C1)(C)C)O)O |
| InChI | InChI=1S/C20H30O2/c1-13(2)16-10-14-6-7-18-19(3,4)8-5-9-20(18,22)12-15(14)11-17(16)21/h10-11,13,18,21-22H,5-9,12H2,1-4H3 |
| InChI Key | UZNOTFOFROXACM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of 12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-1,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1212-dimethyl-6-propan-2-yltricyclo940038pentadeca-357-triene-15-diol.jpg "2D Structure of 12,12-Dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-1,5-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.87% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.63% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.31% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.22% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.05% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.00% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.70% | 99.15% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.37% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.13% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.67% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.52% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.47% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.84% | 93.04% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.74% | 93.56% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.27% | 91.03% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.98% | 99.18% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.94% | 91.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.80% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.43% | 82.69% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.20% | 96.38% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.08% | 93.03% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 81.71% | 93.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.30% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis formosensis |
| Chamaecyparis pisifera |
| Salvia lanigera |
| Salvia przewalskii |
| PubChem | 4022498 |
| LOTUS | LTS0058903 |
| wikiData | Q105282347 |