1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-4,11-diol
| Internal ID | 76e09105-4b23-4054-bd08-6524ab632997 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-4,11-diol |
| SMILES (Canonical) | CN1CC(C2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC)O |
| SMILES (Isomeric) | CN1CC(C2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC)O |
| InChI | InChI=1S/C20H23NO5/c1-21-9-13(22)11-8-15(25-3)20(26-4)18-16-10(7-12(21)17(11)18)5-6-14(24-2)19(16)23/h5-6,8,12-13,22-23H,7,9H2,1-4H3 |
| InChI Key | IBXMDNCFGSBKCQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-4,11-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1210-trimethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline-411-diol.jpg "2D Structure of 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-4,11-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.88% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.34% | 95.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.20% | 93.99% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.46% | 89.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.11% | 91.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.01% | 91.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.24% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.06% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.82% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.78% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.72% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.46% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.66% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.86% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.00% | 95.56% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.42% | 91.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.35% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.26% | 94.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.59% | 88.48% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.41% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aristolochia lagesiana |
| Pseudofumaria lutea |
| PubChem | 162916817 |
| LOTUS | LTS0275807 |
| wikiData | Q105110823 |