[(7R,9S,10R,27S,28R)-15,16,17,20,21,33,34,35,38,39,42,43,44-tridecahydroxy-4,12,25,30,47-pentaoxo-5,8,11,26,29,40,48-heptaoxanonacyclo[20.17.9.03,37.07,28.010,27.013,18.019,24.031,36.041,46]octatetraconta-1(39),2,13,15,17,19,21,23,31,33,35,37,41,43,45-pentadecaen-9-yl] 3,4,5-trihydroxybenzoate
Internal ID | 0c6cd693-f8d5-4ce3-9cf9-169735cf2cb1 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(7R,9S,10R,27S,28R)-15,16,17,20,21,33,34,35,38,39,42,43,44-tridecahydroxy-4,12,25,30,47-pentaoxo-5,8,11,26,29,40,48-heptaoxanonacyclo[20.17.9.03,37.07,28.010,27.013,18.019,24.031,36.041,46]octatetraconta-1(39),2,13,15,17,19,21,23,31,33,35,37,41,43,45-pentadecaen-9-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C3C4C(C(O2)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O4)OC(=O)C8=CC(=C(C(=C8OC9=C(C(=C(C(=C9)C(=O)O1)C1=C(C(=C(C=C1C(=O)O3)O)O)O)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@H]4[C@H]([C@@H](O2)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O4)OC(=O)C8=CC(=C(C(=C8OC9=C(C(=C(C(=C9)C(=O)O1)C1=C(C(=C(C=C1C(=O)O3)O)O)O)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C48H30O30/c49-15-1-9(2-16(50)27(15)54)42(65)78-48-41-40-39-22(74-48)8-71-43(66)12-6-20(31(58)35(62)25(12)23-10(44(67)75-39)3-17(51)28(55)33(23)60)72-38-14(5-19(53)30(57)37(38)64)47(70)73-21-7-13(46(69)76-40)26(36(63)32(21)59)24-11(45(68)77-41)4-18(52)29(56)34(24)61/h1-7,22,39-41,48-64H,8H2/t22-,39-,40+,41-,48+/m1/s1 |
InChI Key | KIEOSZVDQBDZNC-PSAZYJJASA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H30O30 |
Molecular Weight | 1086.70 g/mol |
Exact Mass | 1086.08218953 g/mol |
Topological Polar Surface Area (TPSA) | 500.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of [(7R,9S,10R,27S,28R)-15,16,17,20,21,33,34,35,38,39,42,43,44-tridecahydroxy-4,12,25,30,47-pentaoxo-5,8,11,26,29,40,48-heptaoxanonacyclo[20.17.9.03,37.07,28.010,27.013,18.019,24.031,36.041,46]octatetraconta-1(39),2,13,15,17,19,21,23,31,33,35,37,41,43,45-pentadecaen-9-yl] 3,4,5-trihydroxybenzoate 2D Structure of [(7R,9S,10R,27S,28R)-15,16,17,20,21,33,34,35,38,39,42,43,44-tridecahydroxy-4,12,25,30,47-pentaoxo-5,8,11,26,29,40,48-heptaoxanonacyclo[20.17.9.03,37.07,28.010,27.013,18.019,24.031,36.041,46]octatetraconta-1(39),2,13,15,17,19,21,23,31,33,35,37,41,43,45-pentadecaen-9-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/120b7160-86cb-11ee-9701-9d1d6ed998ce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.80% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.87% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.42% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.17% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.70% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.03% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.60% | 83.57% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.86% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.20% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.99% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.50% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.21% | 97.21% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.17% | 95.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.78% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.53% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 84.12% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.15% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.62% | 95.78% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.19% | 93.40% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.18% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 80.97% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.83% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stachyurus praecox |
PubChem | 162857217 |
LOTUS | LTS0130051 |
wikiData | Q105141469 |