12-Ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(18),2,4,6-tetraen-9-one
Internal ID | a8cb8d2f-b9bb-4e12-8314-ec7e76b14b9e |
Taxonomy | Alkaloids and derivatives > Rhazinilam alkaloids |
IUPAC Name | 12-ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(18),2,4,6-tetraen-9-one |
SMILES (Canonical) | CCC12CCCN3C1C(=CC3)C4=CC=CC=C4NC(=O)CC2 |
SMILES (Isomeric) | CCC12CCCN3C1C(=CC3)C4=CC=CC=C4NC(=O)CC2 |
InChI | InChI=1S/C19H24N2O/c1-2-19-10-5-12-21-13-9-15(18(19)21)14-6-3-4-7-16(14)20-17(22)8-11-19/h3-4,6-7,9,18H,2,5,8,10-13H2,1H3,(H,20,22) |
InChI Key | SITMZXZIMOADTH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24N2O |
Molecular Weight | 296.40 g/mol |
Exact Mass | 296.188863393 g/mol |
Topological Polar Surface Area (TPSA) | 32.30 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of 12-Ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(18),2,4,6-tetraen-9-one 2D Structure of 12-Ethyl-8,16-diazatetracyclo[10.6.1.02,7.016,19]nonadeca-1(18),2,4,6-tetraen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/12-ethyl-816-diazatetracyclo106102701619nonadeca-118246-tetraen-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.96% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 98.95% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.43% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.98% | 95.56% |
CHEMBL240 | Q12809 | HERG | 93.31% | 89.76% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 92.62% | 98.59% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.60% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.10% | 82.69% |
CHEMBL228 | P31645 | Serotonin transporter | 90.83% | 95.51% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 89.84% | 92.97% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.78% | 93.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.09% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.44% | 95.83% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.00% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.79% | 94.75% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.68% | 96.61% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.18% | 90.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.08% | 90.24% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.04% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.09% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kopsia singapurensis |
Leuconotis griffithii |
PubChem | 14442606 |
LOTUS | LTS0086447 |
wikiData | Q105254026 |