(11R)-3,11,17-trihydroxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one
Internal ID | 301e9970-2f55-4cf7-ba05-d57f686357bf |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Cyclic diarylheptanoids > Meta,meta-bridged biphenyls |
IUPAC Name | (11R)-3,11,17-trihydroxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
SMILES (Canonical) | C1CC2=CC(=C(C=C2)O)C3=C(C=CC(=C3)CCC(=O)CC1O)O |
SMILES (Isomeric) | C1CC2=CC(=C(C=C2)O)C3=C(C=CC(=C3)CCC(=O)C[C@@H]1O)O |
InChI | InChI=1S/C19H20O4/c20-14-5-1-12-3-7-18(22)16(9-12)17-10-13(4-8-19(17)23)2-6-15(21)11-14/h3-4,7-10,14,20,22-23H,1-2,5-6,11H2/t14-/m1/s1 |
InChI Key | XVHOPVJSRBYOKK-CQSZACIVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O4 |
Molecular Weight | 312.40 g/mol |
Exact Mass | 312.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.03% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.41% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.57% | 93.40% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.54% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.32% | 99.15% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.69% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.16% | 89.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 84.56% | 95.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.74% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.51% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.48% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.46% | 96.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.91% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alnus japonica |
PubChem | 25751155 |
LOTUS | LTS0069919 |
wikiData | Q105342894 |