Methyl 9-formyl-5-hydroxy-10-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Internal ID | 0602e999-55b1-4acb-a145-b5291f83c1b6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | methyl 9-formyl-5-hydroxy-10-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C=O)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C(=O)OC)C |
SMILES (Isomeric) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C=O)OC6C(C(C(C(O6)CO)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)C(=O)OC)C |
InChI | InChI=1S/C48H76O19/c1-43(2)14-15-48(42(60)61-7)23(16-43)22-8-9-28-44(3)12-11-30(45(4,21-51)27(44)10-13-46(28,5)47(22,6)17-29(48)53)65-41-38(67-40-36(59)34(57)32(55)25(18-49)63-40)37(33(56)26(19-50)64-41)66-39-35(58)31(54)24(52)20-62-39/h8,21,23-41,49-50,52-59H,9-20H2,1-7H3 |
InChI Key | RMAKESVZXWWPDL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H76O19 |
Molecular Weight | 957.10 g/mol |
Exact Mass | 956.49808019 g/mol |
Topological Polar Surface Area (TPSA) | 301.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.69% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.93% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.65% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.77% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.31% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.56% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.41% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 83.64% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.35% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.83% | 92.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.43% | 96.77% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.36% | 89.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.25% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.16% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.94% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.77% | 97.14% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.65% | 91.65% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.87% | 86.92% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.63% | 91.24% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.59% | 95.93% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.51% | 91.07% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.28% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gypsophila paniculata |
PubChem | 75104467 |
LOTUS | LTS0020123 |
wikiData | Q105240652 |