1,1,7,7a-Tetramethyl-1a,2,3,6,7,7b-hexahydrocyclopropa[a]naphthalen-5-one
Internal ID | 1488a9fd-dd85-4276-96d9-51d4b3837091 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Aristolane sesquiterpenoids |
IUPAC Name | 1,1,7,7a-tetramethyl-1a,2,3,6,7,7b-hexahydrocyclopropa[a]naphthalen-5-one |
SMILES (Canonical) | CC1CC(=O)C=C2C1(C3C(C3(C)C)CC2)C |
SMILES (Isomeric) | CC1CC(=O)C=C2C1(C3C(C3(C)C)CC2)C |
InChI | InChI=1S/C15H22O/c1-9-7-11(16)8-10-5-6-12-13(14(12,2)3)15(9,10)4/h8-9,12-13H,5-7H2,1-4H3 |
InChI Key | OHIBAYUTHVYXER-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.73% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.45% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.54% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.25% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.29% | 96.43% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.49% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.87% | 97.25% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.72% | 93.40% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.68% | 97.05% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.40% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.78% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.91% | 90.71% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.71% | 90.17% |
CHEMBL4072 | P07858 | Cathepsin B | 80.62% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Valeriana jatamansi |
PubChem | 78157359 |
LOTUS | LTS0265742 |
wikiData | Q105192091 |