1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol
| Internal ID | 8b956f65-779e-4784-addb-084e94cdac86 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)O)OC)OC)O |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)O)OC)OC)O |
| InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(22)19(24-3)17-15(11)12(20)8-10-4-5-13(21)18(23-2)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3 |
| InChI Key | ZBFSMPOCZMVCMC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of 1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol](https://plantaedb.com/storage/docs/compounds/2023/11/111-dimethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline-210-diol.jpg "2D Structure of 1,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.29% | 95.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.91% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.38% | 93.40% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.25% | 93.99% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.67% | 91.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.43% | 91.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.07% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.73% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.88% | 90.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.47% | 91.03% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 85.05% | 96.76% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.46% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.63% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.46% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.64% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.48% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.14% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.67% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hernandia nymphaeifolia |
| Lindera megaphylla |
| PubChem | 75000759 |
| LOTUS | LTS0115894 |
| wikiData | Q104403004 |