1,11-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol
| Internal ID | 93610852-d3f5-483a-a345-b9eb10e4c9cc |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,11-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| SMILES (Canonical) | COC1=C(C=CC2=C1C3=C4C(C2)NCCC4=CC(=C3OC)O)O |
| SMILES (Isomeric) | COC1=C(C=CC2=C1C3=C4C(C2)NCCC4=CC(=C3OC)O)O |
| InChI | InChI=1S/C18H19NO4/c1-22-17-12(20)4-3-9-7-11-14-10(5-6-19-11)8-13(21)18(23-2)16(14)15(9)17/h3-4,8,11,19-21H,5-7H2,1-2H3 |
| InChI Key | YHVSWHLQYUURMP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 71.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 1,11-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol](https://plantaedb.com/storage/docs/compounds/2023/11/111-dimethoxy-566a7-tetrahydro-4h-dibenzodegquinoline-210-diol.jpg "2D Structure of 1,11-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.81% | 93.99% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.30% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.23% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.24% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.78% | 97.09% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.17% | 92.68% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.17% | 91.79% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 88.27% | 95.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.61% | 90.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.44% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.24% | 95.89% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.19% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.73% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.06% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.55% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.33% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.34% | 92.94% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.77% | 91.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.33% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hernandia nymphaeifolia |
| Illigera luzonensis |
| Lindera myrrha |
| PubChem | 12310425 |
| LOTUS | LTS0237826 |
| wikiData | Q104664559 |