1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol
| Internal ID | 6f1b8eeb-ff98-481f-8ee3-f44f617cea82 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)OC)OC)O |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)OC)OC)O |
| InChI | InChI=1S/C20H23NO4/c1-21-8-7-12-10-14(22)19(24-3)18-16(12)13(21)9-11-5-6-15(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3 |
| InChI Key | MMPSCNRRQGVBGG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 2.60 |
| (6aS)-5,6,6a,7-Tetrahydro-1,10,11-trimethoxy-6-methyl-4H-dibenzo[de,g]quinolin-2-ol; N-Methyl-O10-methylhernovine |
![2D Structure of 1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/11011-trimethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinolin-2-ol.jpg "2D Structure of 1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.96% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 98.19% | 95.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.03% | 91.49% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 95.19% | 96.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.61% | 93.99% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.31% | 91.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.10% | 93.40% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.73% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.00% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.68% | 89.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.36% | 91.79% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.18% | 88.48% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.02% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.36% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.17% | 91.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.83% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.27% | 98.75% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 84.70% | 98.44% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.66% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.27% | 94.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.72% | 92.94% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.60% | 95.78% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.12% | 82.38% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.26% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Litsea glutinosa |
| PubChem | 73176247 |
| LOTUS | LTS0167909 |
| wikiData | Q105167961 |