11-Hydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one
Internal ID | 12c50998-431c-4dea-b51f-193305131e38 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | 11-hydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
SMILES (Canonical) | CC1(CCCC2(C1CCC34C2C(CC(C3)C(=C)C4=O)O)C)C |
SMILES (Isomeric) | CC1(CCCC2(C1CCC34C2C(CC(C3)C(=C)C4=O)O)C)C |
InChI | InChI=1S/C20H30O2/c1-12-13-10-14(21)16-19(4)8-5-7-18(2,3)15(19)6-9-20(16,11-13)17(12)22/h13-16,21H,1,5-11H2,2-4H3 |
InChI Key | CNFJKVOXPKJCBT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O2 |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of 11-Hydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one 2D Structure of 11-Hydroxy-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one](https://plantaedb.com/storage/docs/compounds/2023/11/11-hydroxy-559-trimethyl-14-methylidenetetracyclo11210110049hexadecan-15-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.17% | 82.69% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.58% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.02% | 91.11% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 91.64% | 97.05% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.59% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.46% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.05% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.64% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.62% | 96.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.47% | 93.04% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.47% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 85.94% | 98.95% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.90% | 95.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.72% | 94.45% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.53% | 93.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.31% | 95.89% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.21% | 90.08% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.83% | 93.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.40% | 99.23% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 80.97% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amentotaxus formosana |
Jackiella javanica |
Jungermannia atrovirens |
Jungermannia exsertifolia |
Liochlaena subulata |
PubChem | 14019093 |
LOTUS | LTS0073329 |
wikiData | Q104965717 |