1,1-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine
| Internal ID | 43c494cf-480d-43e5-a42e-88333cce97da |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Acyclic monoterpenoids |
| IUPAC Name | 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine |
| SMILES (Canonical) | CC(=CCCC(=CCN(CC=C(C)CCC=C(C)C)C(=N)N)C)C |
| SMILES (Isomeric) | CC(=CCC/C(=C/CN(C(=N)N)C/C=C(/CCC=C(C)C)\C)/C)C |
| InChI | InChI=1S/C21H37N3/c1-17(2)9-7-11-19(5)13-15-24(21(22)23)16-14-20(6)12-8-10-18(3)4/h9-10,13-14H,7-8,11-12,15-16H2,1-6H3,(H3,22,23)/b19-13+,20-14+ |
| InChI Key | ZEAAMJFQDIQIDJ-IWGRKNQJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.298748193 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 6.00 |
| Nitensidine B |
| nitensidene B |
| CHEMBL454855 |
![2D Structure of 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine](https://plantaedb.com/storage/docs/compounds/2023/11/11-bis2e-37-dimethylocta-26-dienylguanidine.jpg "2D Structure of 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.19% | 96.09% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 92.04% | 97.88% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.31% | 92.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.49% | 90.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.41% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.43% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.90% | 98.95% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.88% | 96.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.28% | 99.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.32% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pterogyne nitens |
| PubChem | 10404473 |
| LOTUS | LTS0123072 |
| wikiData | Q105372960 |