10'(Z),13'(E),15'(E)-Heptadecatrienylhydroquinone
| Internal ID | 79df47bd-66dc-427e-a63a-4a5462238d18 |
| Taxonomy | Benzenoids > Phenols > Benzenediols > Hydroquinones |
| IUPAC Name | 2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol |
| SMILES (Canonical) | CC=CC=CCC=CCCCCCCCCCC1=C(C=CC(=C1)O)O |
| SMILES (Isomeric) | C/C=C/C=C/C/C=C\CCCCCCCCCC1=C(C=CC(=C1)O)O |
| InChI | InChI=1S/C23H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-20-22(24)18-19-23(21)25/h2-5,7-8,18-20,24-25H,6,9-17H2,1H3/b3-2+,5-4+,8-7- |
| InChI Key | OILIDQCJCUQAGV-YCLNNTPMSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 8.20 |
| CHEMBL464638 |
| SCHEMBL23221297 |
| 2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.23% | 98.95% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.23% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.37% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.39% | 96.09% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.66% | 83.57% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.42% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.97% | 94.73% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.82% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 82.31% | 90.71% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.19% | 91.71% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.12% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.74% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Toxicodendron succedaneum |
| PubChem | 11724959 |
| LOTUS | LTS0086701 |
| wikiData | Q105192558 |