10-Methyl-1-undecene
Internal ID | 2ad76e93-2751-4538-a21d-c7f7083fe008 |
Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Unsaturated aliphatic hydrocarbons |
IUPAC Name | 10-methylundec-1-ene |
SMILES (Canonical) | CC(C)CCCCCCCC=C |
SMILES (Isomeric) | CC(C)CCCCCCCC=C |
InChI | InChI=1S/C12H24/c1-4-5-6-7-8-9-10-11-12(2)3/h4,12H,1,5-11H2,2-3H3 |
InChI Key | AQLBDEAOQUJAIE-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C12H24 |
Molecular Weight | 168.32 g/mol |
Exact Mass | 168.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 6.50 |
Isododecene |
1-Undecene, 10-methyl- |
10-methyl-undec-1-ene |
22370-55-4 |
10-Methyl-1-undecene # |
DTXSID20334197 |
AKOS006275656 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 90.69% | 98.95% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 89.40% | 87.45% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.22% | 93.31% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.11% | 96.47% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.07% | 97.29% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 85.29% | 95.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.25% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.61% | 99.17% |
CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 83.05% | 97.29% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.66% | 93.56% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 81.81% | 92.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.63% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.40% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vaccinium corymbosum |
PubChem | 519941 |
LOTUS | LTS0177915 |
wikiData | Q82099908 |