1-Propanone, 3-phenyl-1-(2,4,6-trimethoxyphenyl)-
| Internal ID | b720660c-94a0-465f-89d7-431101b574c5 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids |
| IUPAC Name | 3-phenyl-1-(2,4,6-trimethoxyphenyl)propan-1-one |
| SMILES (Canonical) | COC1=CC(=C(C(=C1)OC)C(=O)CCC2=CC=CC=C2)OC |
| SMILES (Isomeric) | COC1=CC(=C(C(=C1)OC)C(=O)CCC2=CC=CC=C2)OC |
| InChI | InChI=1S/C18H20O4/c1-20-14-11-16(21-2)18(17(12-14)22-3)15(19)10-9-13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3 |
| InChI Key | ASIBRDHUNIEPQI-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 3.40 |
| 92631-81-7 |
| 3-phenyl-1-(2,4,6-trimethoxyphenyl)propan-1-one |
| CHEMBL32992 |
| SCHEMBL17502354 |
| DTXSID00428543 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.36% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.64% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.61% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.74% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.13% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.16% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.77% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.65% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.33% | 98.75% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.98% | 92.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.42% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.96% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Woodsia scopulina |
| PubChem | 7330521 |
| LOTUS | LTS0129942 |
| wikiData | Q82241378 |