1-Oxo-1,2-dihydroisoquinoline-4-carboxylic acid
| Internal ID | 9892cd62-eee2-45e1-b085-69e91d6f7511 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Isoquinolones and derivatives |
| IUPAC Name | 1-oxo-2H-isoquinoline-4-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H7NO3/c12-9-7-4-2-1-3-6(7)8(5-11-9)10(13)14/h1-5H,(H,11,12)(H,13,14) |
| InChI Key | IMEDZEDITFIMAK-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.042593085 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 0.60 |
| 1-oxo-1,2-dihydro-4-isoquinolinecarboxylic acid |
| 1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid |
| 1-oxo-2H-isoquinoline-4-carboxylic acid |
| MFCD00140316 |
| 4-isoquinolinecarboxylic acid, 1,2-dihydro-1-oxo- |
| Bionet2_000184 |
| 1-Hydroxyisoquinoline-4-carboxylic acid |
| MLS000756060 |
| SCHEMBL2676355 |
| CHEMBL1483323 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.84% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.47% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.23% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.54% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.63% | 98.75% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.26% | 94.62% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.59% | 93.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.25% | 95.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.26% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rubus idaeus |
| PubChem | 643161 |
| NPASS | NPC164340 |
| ChEMBL | CHEMBL1483323 |