1-methoxy-8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridine
Internal ID | 60b73b6e-3365-4ace-aecb-8cd5b01d70a1 |
Taxonomy | Organoheterocyclic compounds > Pyranopyridines |
IUPAC Name | 1-methoxy-8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridine |
SMILES (Canonical) | CC1=NC=CC2=C1C(OCC2)OC |
SMILES (Isomeric) | CC1=NC=CC2=C1C(OCC2)OC |
InChI | InChI=1S/C10H13NO2/c1-7-9-8(3-5-11-7)4-6-13-10(9)12-2/h3,5,10H,4,6H2,1-2H3 |
InChI Key | ARIZYLSCDPQLSY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C10H13NO2 |
Molecular Weight | 179.22 g/mol |
Exact Mass | 179.094628657 g/mol |
Topological Polar Surface Area (TPSA) | 31.40 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.81% | 96.09% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 92.81% | 86.79% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 92.30% | 93.65% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.80% | 83.82% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.62% | 91.49% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.22% | 93.99% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.98% | 91.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.79% | 94.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.44% | 92.97% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.62% | 86.33% |
CHEMBL5903 | Q04771 | Activin receptor type-1 | 85.82% | 89.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.53% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.25% | 92.94% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.04% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.03% | 95.56% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.80% | 85.49% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.39% | 96.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.26% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gentiana olivieri |
PubChem | 101411940 |
LOTUS | LTS0148462 |
wikiData | Q104917347 |