1-Methoxy-3-methyl-9H-carbazole
| Internal ID | 6417ca3a-6862-45d0-925b-46a90ae81590 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1-methoxy-3-methyl-9H-carbazole |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)OC)NC3=CC=CC=C32 |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC)NC3=CC=CC=C32 |
| InChI | InChI=1S/C14H13NO/c1-9-7-11-10-5-3-4-6-12(10)15-14(11)13(8-9)16-2/h3-8,15H,1-2H3 |
| InChI Key | HDETUOZJFUNSKG-UHFFFAOYSA-N |
| Popularity | 25 references in papers |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.099714038 g/mol |
| Topological Polar Surface Area (TPSA) | 25.00 Ų |
| XlogP | 3.70 |
| 4532-33-6 |
| Murrayafoline A |
| DTXSID90327415 |
| murrayafoline-A |
| RefChem:160145 |
| DTXCID80278528 |
| 112-419-7 |
| 1-methoxy-3-methylcarbazole |
| MFCD18452402 |
| Murrayafolin a |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.70% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.09% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.20% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.17% | 98.95% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.09% | 85.49% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.94% | 92.98% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.88% | 93.99% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 84.82% | 98.21% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.66% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.04% | 94.00% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 83.42% | 85.40% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.29% | 93.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.17% | 85.14% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.55% | 91.71% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.93% | 87.45% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.51% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera crenulata |
| Bergera euchrestifolia |
| Bergera koenigii |
| Bergera kwangsiensis |
| Bergera stenocarpa |
| Clausena excavata |
| Clausena heptaphylla |
| PubChem | 375150 |
| NPASS | NPC242928 |
| ChEMBL | CHEMBL490667 |
| LOTUS | LTS0072118 |
| wikiData | Q82089208 |