1-methoxy-2-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,9-diol
Internal ID | 19c4d9b0-a4a6-43ee-a718-1c413cdb4589 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 1-methoxy-2-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OCC3C2OC4=C3C=CC(=C4)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OCC3C2OC4=C3C=CC(=C4)O)OC)C |
InChI | InChI=1S/C21H22O5/c1-11(2)4-6-14-16(23)9-18-19(20(14)24-3)21-15(10-25-18)13-7-5-12(22)8-17(13)26-21/h4-5,7-9,15,21-23H,6,10H2,1-3H3 |
InChI Key | HCBAFFVITJAXJE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O5 |
Molecular Weight | 354.40 g/mol |
Exact Mass | 354.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 4.20 |
LMPK12070095 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.80% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.65% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.18% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.23% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.10% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.91% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.05% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.98% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.29% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.78% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 83.64% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.58% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.23% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.84% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.76% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.52% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Desmodium uncinatum |
Glycyrrhiza uralensis |
PubChem | 44257469 |
LOTUS | LTS0067144 |
wikiData | Q105025577 |