1-Hydroxy-3,5,6-trimethoxy-10-methyl-4-(3-methylbut-2-enyl)acridin-9-one
| Internal ID | c20aa8a5-e533-4de0-bc28-4d6a74a6f4b9 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1-hydroxy-3,5,6-trimethoxy-10-methyl-4-(3-methylbut-2-enyl)acridin-9-one |
| SMILES (Canonical) | CC(=CCC1=C(C=C(C2=C1N(C3=C(C2=O)C=CC(=C3OC)OC)C)O)OC)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=C(C2=C1N(C3=C(C2=O)C=CC(=C3OC)OC)C)O)OC)C |
| InChI | InChI=1S/C22H25NO5/c1-12(2)7-8-13-17(27-5)11-15(24)18-19(13)23(3)20-14(21(18)25)9-10-16(26-4)22(20)28-6/h7,9-11,24H,8H2,1-6H3 |
| InChI Key | QGNNTCSQQNPLKN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17327290 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.87% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.62% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.96% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.90% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.81% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.13% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.01% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.96% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.85% | 89.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.83% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.72% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.50% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.60% | 96.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.27% | 96.12% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.99% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.69% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.33% | 85.14% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.77% | 97.21% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.51% | 92.38% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.45% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |
| Turraeanthus africanus |
| PubChem | 163049216 |
| LOTUS | LTS0049182 |
| wikiData | Q105154396 |