1-Hydroxy-3,5-dimethoxy-xanthen-9-one
| Internal ID | 9529730c-6c38-48d5-986a-79ae398e6ec1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1-hydroxy-3,5-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC=CC2=C1OC3=CC(=CC(=C3C2=O)O)OC |
| SMILES (Isomeric) | COC1=CC=CC2=C1OC3=CC(=CC(=C3C2=O)O)OC |
| InChI | InChI=1S/C15H12O5/c1-18-8-6-10(16)13-12(7-8)20-15-9(14(13)17)4-3-5-11(15)19-2/h3-7,16H,1-2H3 |
| InChI Key | IVNMXDMMZVLIRJ-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 3.10 |
| 1-Hydroxy-3,5-dimethoxy-xanthen-9-one |
| SCHEMBL7931361 |
| 1-hydroxy-3,5-dimethoxyxanthone |
| BDBM50155421 |
| 3,5-Dimethoxy-1-dihydroxyxanthen-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.01% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.65% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.25% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.10% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.05% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.50% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.43% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.39% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.19% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.31% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.89% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.98% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.50% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.32% | 94.45% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.79% | 93.65% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.05% | 92.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.96% | 93.31% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.73% | 94.03% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.00% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Canscora alata |
| Chironia krebsii |
| Frasera albomarginata |
| Haploclathra paniculata |
| Swertia calycina |
| Swertia chirayta |
| Swertia hookeri |
| PubChem | 5479773 |
| LOTUS | LTS0197607 |
| wikiData | Q105121146 |