1-Hydroxy-3-methoxy-2-methylanthracene-9,10-dione
Internal ID | 9657af8e-31ad-46a1-baa2-88b3d87b2990 |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
IUPAC Name | 1-hydroxy-3-methoxy-2-methylanthracene-9,10-dione |
SMILES (Canonical) | CC1=C(C=C2C(=C1O)C(=O)C3=CC=CC=C3C2=O)OC |
SMILES (Isomeric) | CC1=C(C=C2C(=C1O)C(=O)C3=CC=CC=C3C2=O)OC |
InChI | InChI=1S/C16H12O4/c1-8-12(20-2)7-11-13(14(8)17)16(19)10-6-4-3-5-9(10)15(11)18/h3-7,17H,1-2H3 |
InChI Key | ZWSWHELBROHJAN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H12O4 |
Molecular Weight | 268.26 g/mol |
Exact Mass | 268.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.68% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 93.80% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.85% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.80% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.72% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.83% | 94.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.82% | 96.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.71% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.51% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.08% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.68% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.34% | 99.15% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.92% | 90.20% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.04% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Galium rubioides |
Plocama pendula |
Rubia wallichiana |
PubChem | 10611938 |
LOTUS | LTS0201663 |
wikiData | Q105385198 |