1-Hydroxy-2,3,6,7-tetramethoxy-10-methylacridin-9-one
| Internal ID | 7278e76e-9855-4239-9be0-998d5251a735 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1-hydroxy-2,3,6,7-tetramethoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=CC(=C(C=C2C(=O)C3=C(C(=C(C=C31)OC)OC)O)OC)OC |
| SMILES (Isomeric) | CN1C2=CC(=C(C=C2C(=O)C3=C(C(=C(C=C31)OC)OC)O)OC)OC |
| InChI | InChI=1S/C18H19NO6/c1-19-10-7-13(23-3)12(22-2)6-9(10)16(20)15-11(19)8-14(24-4)18(25-5)17(15)21/h6-8,21H,1-5H3 |
| InChI Key | HBNBAVVVZLIKJN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.12123733 g/mol |
| Topological Polar Surface Area (TPSA) | 77.50 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.25% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.62% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.83% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.75% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.34% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.03% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.10% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.51% | 94.42% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.27% | 98.75% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.85% | 94.75% |
| CHEMBL3132741 | P55201 | Peregrin | 84.35% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.24% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.89% | 90.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.74% | 95.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus falcatus |
| Millettia griffoniana |
| Vepris nobilis |
| PubChem | 163041408 |
| LOTUS | LTS0146360 |
| wikiData | Q105298412 |