1-(7-Hydroxy-5-methoxyphenanthren-2-yl)oxy-4-methoxyphenanthrene-2,7-diol
| Internal ID | 7ce1ad34-462b-4e4f-9bad-42ce66480bcc |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 1-(7-hydroxy-5-methoxyphenanthren-2-yl)oxy-4-methoxyphenanthrene-2,7-diol |
| SMILES (Canonical) | COC1=C2C(=CC(=C1)O)C=CC3=C2C=CC(=C3)OC4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)O |
| SMILES (Isomeric) | COC1=C2C(=CC(=C1)O)C=CC3=C2C=CC(=C3)OC4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)O |
| InChI | InChI=1S/C30H22O6/c1-34-26-14-20(32)12-18-4-3-17-13-21(7-10-22(17)28(18)26)36-30-24-8-5-16-11-19(31)6-9-23(16)29(24)27(35-2)15-25(30)33/h3-15,31-33H,1-2H3 |
| InChI Key | ONUOFMHWDKEYJF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H22O6 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.58% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.96% | 91.79% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.51% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.01% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 93.38% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.49% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.90% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.54% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.29% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.70% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.22% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 86.97% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.03% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.28% | 92.94% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.52% | 92.68% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.69% | 90.20% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.89% | 94.42% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.59% | 93.99% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.27% | 94.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 101634591 |
| LOTUS | LTS0143824 |
| wikiData | Q105195120 |