1-[(7-Hydroxy-4-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-4-methoxyphenanthrene-2,7-diol
| Internal ID | f1245b23-bff0-46e3-891c-edc2362b638f |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 1-[(7-hydroxy-4-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-4-methoxyphenanthrene-2,7-diol |
| SMILES (Canonical) | COC1=CC(=CC2=C1C3=C(CC2)C=C(C=C3)O)OC4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1C3=C(CC2)C=C(C=C3)O)OC4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)O |
| InChI | InChI=1S/C30H24O6/c1-34-26-14-21(13-18-4-3-16-11-19(31)6-9-22(16)28(18)26)36-30-24-8-5-17-12-20(32)7-10-23(17)29(24)27(35-2)15-25(30)33/h5-15,31-33H,3-4H2,1-2H3 |
| InChI Key | RZEWBLKZBGFDET-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 6.70 |
| There are no found synonyms. |
![2D Structure of 1-[(7-Hydroxy-4-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-4-methoxyphenanthrene-2,7-diol](https://plantaedb.com/storage/docs/compounds/2023/11/1-7-hydroxy-4-methoxy-910-dihydrophenanthren-2-yloxy-4-methoxyphenanthrene-27-diol.jpg "2D Structure of 1-[(7-Hydroxy-4-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-4-methoxyphenanthrene-2,7-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL242 | Q92731 | Estrogen receptor beta | 99.02% | 98.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 98.21% | 91.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.40% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.92% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.38% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.51% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.74% | 89.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.52% | 91.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 91.50% | 92.68% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.92% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.74% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.91% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.55% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.14% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.72% | 92.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.68% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.19% | 95.78% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.86% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 85.88% | 89.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.53% | 93.99% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.26% | 93.31% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.02% | 96.67% |
| CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 83.92% | 86.19% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.08% | 96.76% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.17% | 93.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.50% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.48% | 95.89% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.51% | 94.03% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.13% | 95.56% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.13% | 95.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 163008939 |
| LOTUS | LTS0087951 |
| wikiData | Q105248343 |