1-(7-Hydroxy-3,5-dimethoxy-9,10-dihydrophenanthren-2-yl)-4,7-dimethoxyphenanthren-2-ol
| Internal ID | 3e89ca33-4114-4f34-9b61-45c141255436 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 1-(7-hydroxy-3,5-dimethoxy-9,10-dihydrophenanthren-2-yl)-4,7-dimethoxyphenanthren-2-ol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C(C=C5C(=C4)CCC6=C5C(=CC(=C6)O)OC)OC)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C(C=C5C(=C4)CCC6=C5C(=CC(=C6)O)OC)OC)O)OC |
| InChI | InChI=1S/C32H28O6/c1-35-21-8-10-22-17(12-21)7-9-23-31(26(34)16-29(38-4)32(22)23)25-13-18-5-6-19-11-20(33)14-28(37-3)30(19)24(18)15-27(25)36-2/h7-16,33-34H,5-6H2,1-4H3 |
| InChI Key | PJPNKQNHGYEFTE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 7.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.39% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 98.09% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 96.16% | 90.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 93.54% | 92.68% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.23% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.13% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.94% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.95% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.23% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.00% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.50% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.73% | 98.75% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 89.27% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.57% | 98.95% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 88.36% | 95.12% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.11% | 89.62% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.77% | 95.78% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.67% | 92.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.29% | 91.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.13% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.53% | 95.89% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.12% | 93.31% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 83.92% | 94.67% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.76% | 96.12% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.07% | 96.21% |
| CHEMBL240 | Q12809 | HERG | 82.66% | 89.76% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.79% | 96.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.29% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 122178803 |
| LOTUS | LTS0080522 |
| wikiData | Q105210085 |