1-(5-hydroxy-3-methylpentyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol
| Internal ID | fea3e457-9799-4a56-bb6e-7e09c16e0ec2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 1-(5-hydroxy-3-methylpentyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES (Canonical) | CC(CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)CCO |
| SMILES (Isomeric) | CC(CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)CCO |
| InChI | InChI=1S/C20H38O2/c1-15(10-14-21)7-8-17-19(4)12-6-11-18(2,3)16(19)9-13-20(17,5)22/h15-17,21-22H,6-14H2,1-5H3 |
| InChI Key | MCHQEVJMCLOQAZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.287180451 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.39% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.97% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.87% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.76% | 82.69% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.67% | 89.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.80% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.59% | 97.09% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 86.23% | 95.36% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.94% | 94.75% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.85% | 98.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.80% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.53% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.47% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.67% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.96% | 96.61% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.56% | 92.98% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.82% | 95.92% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.79% | 98.33% |
| CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 81.56% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.15% | 96.38% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.02% | 98.05% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.59% | 97.56% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.57% | 98.46% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.55% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.43% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aeonium lindleyi |
| Cistus ladanifer |
| Haplopappus glutinosus |
| Senegalia pennata |
| PubChem | 14239431 |
| LOTUS | LTS0153461 |
| wikiData | Q105161216 |