1-[(3R,4R)-3-ethenyl-4-[(3R)-3-hydroxy-3-quinolin-4-ylpropyl]piperidin-1-yl]ethanone
| Internal ID | 81d8b1cf-fdfd-4f62-a0e5-233260f99d31 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > 4-quinolinemethanols |
| IUPAC Name | 1-[(3R,4R)-3-ethenyl-4-[(3R)-3-hydroxy-3-quinolin-4-ylpropyl]piperidin-1-yl]ethanone |
| SMILES (Canonical) | CC(=O)N1CCC(C(C1)C=C)CCC(C2=CC=NC3=CC=CC=C23)O |
| SMILES (Isomeric) | CC(=O)N1CC[C@H]([C@H](C1)C=C)CC[C@H](C2=CC=NC3=CC=CC=C23)O |
| InChI | InChI=1S/C21H26N2O2/c1-3-16-14-23(15(2)24)13-11-17(16)8-9-21(25)19-10-12-22-20-7-5-4-6-18(19)20/h3-7,10,12,16-17,21,25H,1,8-9,11,13-14H2,2H3/t16-,17+,21+/m0/s1 |
| InChI Key | MGPFTVVETKCWEH-CSODHUTKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.199428076 g/mol |
| Topological Polar Surface Area (TPSA) | 53.40 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 1-[(3R,4R)-3-ethenyl-4-[(3R)-3-hydroxy-3-quinolin-4-ylpropyl]piperidin-1-yl]ethanone](https://plantaedb.com/storage/docs/compounds/2023/11/1-3r4r-3-ethenyl-4-3r-3-hydroxy-3-quinolin-4-ylpropylpiperidin-1-ylethanone.jpg "2D Structure of 1-[(3R,4R)-3-ethenyl-4-[(3R)-3-hydroxy-3-quinolin-4-ylpropyl]piperidin-1-yl]ethanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.10% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.67% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.47% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.56% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.22% | 89.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.66% | 98.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.75% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.92% | 90.08% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.55% | 90.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.73% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.42% | 93.10% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.68% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.35% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ciliosemina pedunculata |
| PubChem | 11198542 |
| LOTUS | LTS0198107 |
| wikiData | Q105163474 |