1-(3-Hydroxyphenyl)ethanol
| Internal ID | 1079e7d5-21f9-4bdc-b020-cac7ccf6fd8d |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
| IUPAC Name | 3-(1-hydroxyethyl)phenol |
| SMILES (Canonical) | CC(C1=CC(=CC=C1)O)O |
| SMILES (Isomeric) | CC(C1=CC(=CC=C1)O)O |
| InChI | InChI=1S/C8H10O2/c1-6(9)7-3-2-4-8(10)5-7/h2-6,9-10H,1H3 |
| InChI Key | COJRWHSKVYUZHQ-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.068079557 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 0.50 |
| 3-(1-hydroxyethyl)phenol |
| RefChem:489492 |
| 808-121-8 |
| 1-(3-HYDROXYPHENYL)ETHANOL |
| 3-HYDROXYPHENYLMETHYLCARBINOL |
| MFCD00238621 |
| 3-hydroxy-alpha-methylbenzyl alcohol |
| 3-Hydroxy-|A-methylbenzyl Alcohol |
| (S)-3-(1-Hydroxyethyl)phenol |
| 194545-44-3 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.48% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.08% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.40% | 97.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.78% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.90% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.59% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.63% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.85% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.10% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.29% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.15% | 93.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.08% | 93.81% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.07% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Oxalis pes-caprae |
| PubChem | 13542886 |
| LOTUS | LTS0206692 |
| wikiData | Q104967091 |