1-(2-Hydroxy-6-methoxyphenyl)-9-(4-methoxyphenyl)-1-nonanone
| Internal ID | a10a0cc9-7b30-4ec3-9b0d-01d9bc81eba1 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | 1-(2-hydroxy-6-methoxyphenyl)-9-(4-methoxyphenyl)nonan-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)CCCCCCCCC(=O)C2=C(C=CC=C2OC)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CCCCCCCCC(=O)C2=C(C=CC=C2OC)O |
| InChI | InChI=1S/C23H30O4/c1-26-19-16-14-18(15-17-19)10-7-5-3-4-6-8-11-20(24)23-21(25)12-9-13-22(23)27-2/h9,12-17,25H,3-8,10-11H2,1-2H3 |
| InChI Key | FTCDLTSVWNEFFF-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 6.70 |
| 1-(2-hydroxy-6-methoxyphenyl)-9-(4-methoxyphenyl)-1-nonanone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.65% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.45% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.65% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.53% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.63% | 90.24% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.69% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.15% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.12% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.08% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.47% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.82% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.15% | 96.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.45% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.90% | 94.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.04% | 95.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.87% | 96.95% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.18% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Myristica fragrans |
| PubChem | 13965862 |
| LOTUS | LTS0165750 |
| wikiData | Q105000973 |