1-(2-Hydroxy-4,7-dimethoxyphenanthren-1-yl)-5-methoxy-9,10-dihydrophenanthrene-2,7-diol
| Internal ID | 853ed599-45e2-4c72-b751-6e48fa97ceca |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 1-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-5-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C(C=CC5=C4CCC6=C5C(=CC(=C6)O)OC)O)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C(C=CC5=C4CCC6=C5C(=CC(=C6)O)OC)O)O)OC |
| InChI | InChI=1S/C31H26O6/c1-35-19-6-9-20-16(13-19)4-8-23-29(20)27(37-3)15-25(34)31(23)30-22-7-5-17-12-18(32)14-26(36-2)28(17)21(22)10-11-24(30)33/h4,6,8-15,32-34H,5,7H2,1-3H3 |
| InChI Key | SPYPVTXQKIVDMJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H26O6 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.74% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 98.42% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 96.77% | 90.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.52% | 98.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.63% | 99.15% |
| CHEMBL240 | Q12809 | HERG | 94.08% | 89.76% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.05% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.31% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.03% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.65% | 94.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.04% | 91.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.98% | 95.12% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.36% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.09% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.15% | 86.33% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.64% | 88.48% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.23% | 95.78% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.18% | 92.68% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.40% | 89.62% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.94% | 96.12% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.60% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.04% | 92.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.84% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.03% | 95.89% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.73% | 93.18% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.42% | 94.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.90% | 96.21% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 82.19% | 94.67% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.98% | 80.78% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 81.59% | 97.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.49% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla striata |
| PubChem | 122178806 |
| LOTUS | LTS0087745 |
| wikiData | Q105257686 |