[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Internal ID | cb41887c-64f9-4e56-859b-ae641a0713bc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)OC9C(C(C(C(O9)CO)O)O)O)C)C)C)O)OC1CC(C(C(C1O)O)O)CO)C)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)OC9C(C(C(C(O9)CO)O)O)O)C)C)C)O)OC1CC(C(C(C1O)O)O)CO)C)O)O)O)O |
InChI | InChI=1S/C59H94O24/c1-24-11-16-59(54(74)83-51-45(72)43(70)40(67)32(22-61)79-51)18-17-57(7)28(29(59)19-24)9-10-34-56(6)14-13-35(55(4,5)33(56)12-15-58(34,57)8)80-53-49(47(30(62)23-75-53)78-31-20-27(21-60)38(65)42(69)39(31)66)82-52-46(73)48(37(64)26(3)77-52)81-50-44(71)41(68)36(63)25(2)76-50/h9,25-27,29-53,60-73H,1,10-23H2,2-8H3 |
InChI Key | BHXHPYYQPVBJAZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H94O24 |
Molecular Weight | 1187.40 g/mol |
Exact Mass | 1186.61350386 g/mol |
Topological Polar Surface Area (TPSA) | 383.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate 2D Structure of [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/0faf6d70-85f1-11ee-8b91-156ef0acf3a6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.92% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.75% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.94% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.17% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.68% | 97.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.74% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.50% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.55% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.95% | 89.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.14% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.81% | 97.93% |
CHEMBL5028 | O14672 | ADAM10 | 85.42% | 97.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.23% | 95.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.65% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.20% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.73% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.98% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.63% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.62% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.45% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guaiacum officinale |
PubChem | 162878079 |
LOTUS | LTS0083261 |
wikiData | Q104936292 |