[(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate
Internal ID | d37c7629-bf8b-44d0-9614-edafcee7bcc6 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)OC)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)OC(=O)/C=C/C6=CC(=C(C=C6)OC)O)O |
InChI | InChI=1S/C31H40O17/c1-12-20(36)26(45-18(35)6-4-13-3-5-16(41-2)15(34)9-13)24(40)30(43-12)46-25-14-7-8-42-28(19(14)31(11-33)27(25)48-31)47-29-23(39)22(38)21(37)17(10-32)44-29/h3-9,12,14,17,19-30,32-34,36-40H,10-11H2,1-2H3/b6-4+/t12-,14+,17+,19+,20-,21+,22-,23+,24+,25-,26+,27-,28-,29+,30-,31+/m0/s1 |
InChI Key | JHANNGATDMZMHI-AQDUFANCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C31H40O17 |
Molecular Weight | 684.60 g/mol |
Exact Mass | 684.22654980 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate 2D Structure of [(2S,3R,4R,5S,6S)-3,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-4-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/0d81bd90-861f-11ee-bdd3-ed1a2b7f8044.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.52% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.81% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.94% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.50% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.43% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.72% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.11% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.85% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 88.21% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.78% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.57% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.03% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.79% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.24% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.96% | 94.45% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.31% | 98.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.13% | 94.73% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.81% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.69% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.90% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.06% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbascum thapsus |
PubChem | 163185616 |
LOTUS | LTS0105752 |
wikiData | Q105127809 |