3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one
Internal ID | c3196964-00c0-4548-9f82-82f55736b698 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)OC=C(C2=O)C3=CC=C(C=C3)OC4C(C(C(C(O4)COC5C(C(CO5)(CO)O)O)O)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)OC=C(C2=O)C3=CC=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@](CO5)(CO)O)O)O)O)O)O)OC |
InChI | InChI=1S/C28H32O15/c1-37-16-7-15-18(21(32)24(16)38-2)19(30)14(8-39-15)12-3-5-13(6-4-12)42-26-23(34)22(33)20(31)17(43-26)9-40-27-25(35)28(36,10-29)11-41-27/h3-8,17,20,22-23,25-27,29,31-36H,9-11H2,1-2H3/t17-,20-,22+,23-,25+,26-,27-,28-/m1/s1 |
InChI Key | PMQDVDNUZOVYCU-ASMIUSRBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O15 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 223.00 Ų |
XlogP | -0.60 |
ACon1_000311 |
NCGC00180685-01 |
BRD-K19457814-001-01-0 |
![2D Structure of 3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one 2D Structure of 3-[4-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-6,7-dimethoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/07/0d58d2a0-26d9-11ee-b4af-c1d910fb97f2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 98.35% | 92.98% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 98.20% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.85% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.83% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.50% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.08% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.48% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.52% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.36% | 95.83% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.67% | 94.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.56% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.30% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.15% | 96.00% |
CHEMBL5747 | Q92793 | CREB-binding protein | 86.34% | 95.12% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.25% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.28% | 86.92% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.17% | 95.53% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.58% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.87% | 90.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.61% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.22% | 90.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.15% | 94.33% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.57% | 96.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.53% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arnica longifolia |
Dalbergia nigra |
Glycosmis pentaphylla |
Kaempferia galanga |
Rubus rigidus |
PubChem | 24094147 |
NPASS | NPC135107 |
LOTUS | LTS0071587 |
wikiData | Q105211654 |