3-(Acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl 2-methylbut-2-enoate
Internal ID | dbf32247-8dc9-4936-9940-cd0b6f0617d5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [14-acetyloxy-6-(furan-3-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(COC3C2C1(C(C4(C3OC5C4=C(C(C5)C6=COC=C6)C)C)CC(=O)OC)C)C)OC(=O)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C2(COC3C2C1(C(C4(C3OC5C4=C(C(C5)C6=COC=C6)C)C)CC(=O)OC)C)C)OC(=O)C |
InChI | InChI=1S/C34H44O9/c1-9-17(2)31(37)43-25-14-24(41-19(4)35)32(5)16-40-28-29(32)33(25,6)23(13-26(36)38-8)34(7)27-18(3)21(20-10-11-39-15-20)12-22(27)42-30(28)34/h9-11,15,21-25,28-30H,12-14,16H2,1-8H3 |
InChI Key | CJHBVBNPNXOWBA-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C34H44O9 |
Molecular Weight | 596.70 g/mol |
Exact Mass | 596.29853298 g/mol |
Topological Polar Surface Area (TPSA) | 111.00 Ų |
XlogP | 3.90 |
[14-Acetyloxy-6-(furan-3-yl)-10-(2-methoxy-2-oxoethyl)-7,9,11,15-tetramethyl-3,17-dioxapentacyclo[9.6.1.02,9.04,8.015,18]octadec-7-en-12-yl] 2-methylbut-2-enoate |
3-(Acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl 2-methylbut-2-enoate |
![2D Structure of 3-(Acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl 2-methylbut-2-enoate 2D Structure of 3-(Acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/0c51a1f0-8571-11ee-af82-e1bc13f8e0cf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.26% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.97% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.92% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.79% | 90.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.90% | 94.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.98% | 81.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.50% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.29% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.17% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.41% | 85.14% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.21% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.05% | 92.62% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.73% | 87.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.50% | 89.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.44% | 93.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.23% | 89.44% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.07% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 83.90% | 97.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.52% | 94.73% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.50% | 97.53% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.45% | 89.67% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.13% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.30% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.07% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.19% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Melia azedarach |
Melia dubia |
PubChem | 4482272 |
LOTUS | LTS0175012 |
wikiData | Q103817778 |