[14-[4-Hydroxy-5-sulfooxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] hydrogen sulfate
Internal ID | d5b98005-5c11-4f73-80b2-c335603f9ca1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [14-[4-hydroxy-5-sulfooxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] hydrogen sulfate |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)OS(=O)(=O)O)OC6C(C(C(CO6)OS(=O)(=O)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC18CCC(=C)CO8 |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)OS(=O)(=O)O)OC6C(C(C(CO6)OS(=O)(=O)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC18CCC(=C)CO8 |
InChI | InChI=1S/C38H58O18S2/c1-17-8-11-38(50-15-17)18(2)28-25(54-38)14-24-22-7-6-20-12-21(55-57(43,44)45)13-27(37(20,5)23(22)9-10-36(24,28)4)52-35-33(30(40)26(16-49-35)56-58(46,47)48)53-34-32(42)31(41)29(39)19(3)51-34/h6,18-19,21-35,39-42H,1,7-16H2,2-5H3,(H,43,44,45)(H,46,47,48) |
InChI Key | AYNJOZRDZXDVJY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H58O18S2 |
Molecular Weight | 867.00 g/mol |
Exact Mass | 866.30645734 g/mol |
Topological Polar Surface Area (TPSA) | 280.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of [14-[4-Hydroxy-5-sulfooxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] hydrogen sulfate 2D Structure of [14-[4-Hydroxy-5-sulfooxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] hydrogen sulfate](https://plantaedb.com/storage/docs/compounds/2023/11/0bcb6520-85bc-11ee-bdf1-91d4b3383a45.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 96.70% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.11% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.11% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.42% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.09% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.26% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.84% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.01% | 94.45% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.23% | 94.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.82% | 94.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.45% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.16% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.94% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 85.91% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 85.59% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.78% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.73% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.97% | 97.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.63% | 96.43% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.78% | 98.46% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.44% | 96.90% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.10% | 85.31% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.78% | 93.40% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.47% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruscus colchicus |
PubChem | 162936740 |
LOTUS | LTS0236918 |
wikiData | Q104921268 |