2-hydroxy-N-[(2S,3R,4E,8E)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-4,8-dien-2-yl]icosanamide
Internal ID | 1686a4af-3531-4c7d-b860-1038e5534458 |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids > Simple glycosylceramides > Glycosyl-N-acylsphingosines |
IUPAC Name | 2-hydroxy-N-[(2S,3R,4E,8E)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-4,8-dien-2-yl]icosanamide |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCC(C(=O)NC(COC1C(C(C(C(O1)CO)O)O)O)C(C=CCCC=CCCCCCCCCC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCC(C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H](/C=C/CC/C=C/CCCCCCCCC)O)O |
InChI | InChI=1S/C44H83NO9/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-38(48)43(52)45-36(35-53-44-42(51)41(50)40(49)39(34-46)54-44)37(47)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h22,24,30,32,36-42,44,46-51H,3-21,23,25-29,31,33-35H2,1-2H3,(H,45,52)/b24-22+,32-30+/t36-,37+,38?,39+,40+,41-,42+,44+/m0/s1 |
InChI Key | DCBUKXJYPRDHOR-GHGJWGTDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C44H83NO9 |
Molecular Weight | 770.10 g/mol |
Exact Mass | 769.60678323 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 11.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.87% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.71% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.39% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.85% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.63% | 92.86% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.57% | 97.29% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.17% | 92.08% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.49% | 92.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.79% | 91.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.98% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.51% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.23% | 94.33% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.94% | 85.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.76% | 90.17% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.66% | 96.47% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.30% | 89.63% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.17% | 91.81% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.42% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.55% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.80% | 96.95% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.79% | 82.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.18% | 89.34% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.78% | 92.88% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.17% | 92.32% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.12% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.68% | 91.19% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.67% | 97.47% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.38% | 89.50% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.73% | 96.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.52% | 97.21% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.55% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arisaema amurense |
PubChem | 6915884 |
LOTUS | LTS0251463 |
wikiData | Q104975163 |