2-[[2-[[5-(diaminomethylideneamino)-2-[[4-hydroxy-12-(2-methylpropyl)-3,8,11,14-tetraoxo-15-[(5-oxopyrrolidine-2-carbonyl)amino]-9,16-di(propan-2-yl)-2,7,10,13-tetrazatricyclo[15.3.1.04,20]henicosa-1(20),17(21),18-triene-6-carbonyl]amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid
Internal ID | a41d943a-ca98-41e7-9113-5072b559c941 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[[4-hydroxy-12-(2-methylpropyl)-3,8,11,14-tetraoxo-15-[(5-oxopyrrolidine-2-carbonyl)amino]-9,16-di(propan-2-yl)-2,7,10,13-tetrazatricyclo[15.3.1.04,20]henicosa-1(20),17(21),18-triene-6-carbonyl]amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)NC(CC2(C3=C(C=C(C=C3)C(C(C(=O)N1)NC(=O)C4CCC(=O)N4)C(C)C)NC2=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(CC5=CN=CN5)C(=O)O)C(C)C |
SMILES (Isomeric) | CC(C)CC1C(=O)NC(C(=O)NC(CC2(C3=C(C=C(C=C3)C(C(C(=O)N1)NC(=O)C4CCC(=O)N4)C(C)C)NC2=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(CC5=CN=CN5)C(=O)O)C(C)C |
InChI | InChI=1S/C47H68N14O12/c1-21(2)14-30-40(66)60-36(23(5)6)42(68)58-32(41(67)56-27(8-7-13-51-46(48)49)38(64)52-19-34(63)55-31(44(70)71)16-25-18-50-20-53-25)17-47(73)26-10-9-24(15-29(26)59-45(47)72)35(22(3)4)37(43(69)57-30)61-39(65)28-11-12-33(62)54-28/h9-10,15,18,20-23,27-28,30-32,35-37,73H,7-8,11-14,16-17,19H2,1-6H3,(H,50,53)(H,52,64)(H,54,62)(H,55,63)(H,56,67)(H,57,69)(H,58,68)(H,59,72)(H,60,66)(H,61,65)(H,70,71)(H4,48,49,51) |
InChI Key | WLPGUHPHCNSPOQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H68N14O12 |
Molecular Weight | 1021.10 g/mol |
Exact Mass | 1020.51411366 g/mol |
Topological Polar Surface Area (TPSA) | 413.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
![2D Structure of 2-[[2-[[5-(diaminomethylideneamino)-2-[[4-hydroxy-12-(2-methylpropyl)-3,8,11,14-tetraoxo-15-[(5-oxopyrrolidine-2-carbonyl)amino]-9,16-di(propan-2-yl)-2,7,10,13-tetrazatricyclo[15.3.1.04,20]henicosa-1(20),17(21),18-triene-6-carbonyl]amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid 2D Structure of 2-[[2-[[5-(diaminomethylideneamino)-2-[[4-hydroxy-12-(2-methylpropyl)-3,8,11,14-tetraoxo-15-[(5-oxopyrrolidine-2-carbonyl)amino]-9,16-di(propan-2-yl)-2,7,10,13-tetrazatricyclo[15.3.1.04,20]henicosa-1(20),17(21),18-triene-6-carbonyl]amino]pentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/0ba38390-86eb-11ee-ad84-aff2681f28a1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.56% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.37% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.40% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.70% | 97.09% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.21% | 95.38% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.45% | 97.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.03% | 90.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.80% | 93.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.80% | 94.75% |
CHEMBL236 | P41143 | Delta opioid receptor | 94.86% | 99.35% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 94.40% | 96.67% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 94.11% | 88.42% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.78% | 97.64% |
CHEMBL2535 | P11166 | Glucose transporter | 93.60% | 98.75% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.42% | 95.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.18% | 90.71% |
CHEMBL4608 | P33032 | Melanocortin receptor 5 | 93.13% | 97.00% |
CHEMBL4644 | P41968 | Melanocortin receptor 3 | 92.57% | 99.52% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.55% | 98.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.53% | 96.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.54% | 96.47% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.43% | 89.63% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.28% | 90.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.84% | 100.00% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.80% | 88.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.00% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.34% | 95.93% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.16% | 89.50% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.02% | 100.00% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 88.60% | 95.42% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.53% | 98.05% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.54% | 96.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.98% | 82.69% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 86.66% | 82.86% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.55% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.34% | 99.23% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.34% | 95.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.31% | 95.89% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 86.31% | 80.71% |
CHEMBL5028 | O14672 | ADAM10 | 85.78% | 97.50% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.78% | 85.11% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 85.49% | 87.16% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.43% | 95.89% |
CHEMBL1628481 | P35414 | Apelin receptor | 85.25% | 97.89% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.83% | 90.20% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.58% | 85.31% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.37% | 96.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.99% | 96.21% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.79% | 93.03% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.02% | 93.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.37% | 96.38% |
CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 80.82% | 93.33% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.51% | 100.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.08% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
PubChem | 152772158 |
LOTUS | LTS0094784 |
wikiData | Q105308143 |