(3R,4R,4aR,5R,6aR,6aS,6bR,8aS,9R,10S,12aR,14bS)-4a,9-bis(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4,5,10-tetrol
Internal ID | e9455f03-6cdb-4dbd-8135-6de46d6bea09 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3R,4R,4aR,5R,6aR,6aS,6bR,8aS,9R,10S,12aR,14bS)-4a,9-bis(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4,5,10-tetrol |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1O)O)CO)O)C)C)(C)CO)O)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H]([C@@]([C@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(C[C@H]([C@@]5([C@H]4CC([C@H]([C@@H]5O)O)(C)C)CO)O)C)C)(C)CO)O |
InChI | InChI=1S/C30H50O6/c1-25(2)13-18-17-7-8-20-26(3)11-10-21(33)27(4,15-31)19(26)9-12-28(20,5)29(17,6)14-22(34)30(18,16-32)24(36)23(25)35/h7,18-24,31-36H,8-16H2,1-6H3/t18-,19-,20+,21-,22+,23-,24-,26-,27-,28+,29+,30-/m0/s1 |
InChI Key | VKJLHZZPVLQJKG-PFWHZVOCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O6 |
Molecular Weight | 506.70 g/mol |
Exact Mass | 506.36073931 g/mol |
Topological Polar Surface Area (TPSA) | 121.00 Ų |
XlogP | 4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.00% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.14% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.84% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.72% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.77% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.65% | 95.93% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.39% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.67% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.16% | 100.00% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 83.61% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.44% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.89% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.82% | 90.00% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.23% | 91.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
PubChem | 162915211 |
LOTUS | LTS0077563 |
wikiData | Q105287814 |