[(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aS,10R,11R,12aR,14bR)-3',4',5',10,11,17',18',19'-octahydroxy-2,2,6a,6b,12a-pentamethyl-8',14'-dioxospiro[1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-9,11'-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene]-4a-carboxylate
| Internal ID | 2a0ece7f-3e61-45aa-a5bf-95c06f6c88f5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl] (4aS,6aR,6aS,6bR,8aS,10R,11R,12aR,14bR)-3',4',5',10,11,17',18',19'-octahydroxy-2,2,6a,6b,12a-pentamethyl-8',14'-dioxospiro[1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-9,11'-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene]-4a-carboxylate |
| SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C56COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)OC6)O)O)O)O)O)O)O)O)C)C)C2C1)C)C(=O)OC9C(C(C(C(O9)CO)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@@]([C@H]1CC=C4[C@]2(CC[C@@]5([C@@H]4CC(CC5)(C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)C)(C[C@H]([C@@H](C38COC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C=C1C(=O)OC8)O)O)O)O)O)O)O)O)C |
| InChI | InChI=1S/C57H68O23/c1-52(2)10-12-56(51(75)80-50-44(70)45(41(67)33(20-58)78-50)79-47(72)23-14-28(59)38(64)29(60)15-23)13-11-54(4)26(27(56)18-52)6-7-34-53(3)19-32(63)46(71)57(35(53)8-9-55(34,54)5)21-76-48(73)24-16-30(61)39(65)42(68)36(24)37-25(49(74)77-22-57)17-31(62)40(66)43(37)69/h6,14-17,27,32-35,41,44-46,50,58-71H,7-13,18-22H2,1-5H3/t27-,32-,33-,34-,35+,41-,44-,45+,46+,50+,53-,54-,55-,56+/m1/s1 |
| InChI Key | GPAPRZPSOQVTFF-LAMPIYGUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C57H68O23 |
| Molecular Weight | 1121.10 g/mol |
| Exact Mass | 1120.41513841 g/mol |
| Topological Polar Surface Area (TPSA) | 398.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.91% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 99.64% | 95.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.46% | 98.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 96.68% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.56% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.52% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.98% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.75% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.70% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.64% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.29% | 82.69% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.28% | 86.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.21% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.15% | 94.45% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.13% | 91.07% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.38% | 94.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.33% | 92.50% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.64% | 92.98% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.25% | 83.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.88% | 96.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.03% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.85% | 99.15% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.45% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Castanopsis cuspidata |
| PubChem | 162933292 |
| LOTUS | LTS0134403 |
| wikiData | Q105014744 |