[2-Hydroxy-11-(hydroxymethyl)-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] 2-methylbut-2-enoate
Internal ID | 45cc5611-d023-4450-8bd3-e2a841ff2a3b |
Taxonomy | Organoheterocyclic compounds > Furofurans |
IUPAC Name | [2-hydroxy-11-(hydroxymethyl)-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C23C1C(CC4C(C2)C(O3)(C(=O)O4)CO)C)(C)O |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C23C1C(CC4C(C2)C(O3)(C(=O)O4)CO)C)(C)O |
InChI | InChI=1S/C20H28O7/c1-5-10(2)16(22)25-14-8-18(4,24)20-7-12-13(6-11(3)15(14)20)26-17(23)19(12,9-21)27-20/h5,11-15,21,24H,6-9H2,1-4H3 |
InChI Key | DUXSVGFBRFRXFC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O7 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.84% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.68% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.31% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.86% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.68% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.94% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.80% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.33% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.03% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.56% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.69% | 97.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.83% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.74% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.39% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gaillardia pulchella |
Hymenoxys lemmonii |
PubChem | 163090462 |
LOTUS | LTS0161169 |
wikiData | Q104989647 |