5-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | ba975ab9-158f-4483-8d7f-431adcdc04a6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1O)C(=O)C(CO2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1O)C(=O)C(CO2)C3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H24O11/c1-30-21-13(32-22-20(29)19(28)17(26)14(7-23)33-22)6-12-15(18(21)27)16(25)11(8-31-12)9-2-4-10(24)5-3-9/h2-6,11,14,17,19-20,22-24,26-29H,7-8H2,1H3 |
InChI Key | LRRDCIMOYDXDJD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O11 |
Molecular Weight | 464.40 g/mol |
Exact Mass | 464.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of 5-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/06aa21d0-8576-11ee-8b71-11cdd7af8a27.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.28% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.52% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.01% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.21% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.72% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.64% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.03% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.11% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.27% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.11% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.38% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.12% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.75% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.04% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.51% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.67% | 96.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.00% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viola hondoensis |
PubChem | 76045301 |
LOTUS | LTS0191778 |
wikiData | Q105156270 |