2-[[(10S,16S,21S,24S,27S,28R)-21-butan-2-yl-16-[3-(diaminomethylideneamino)propyl]-24-(2-methylpropyl)-12,15,17,20,23,26-hexaoxo-27-[[2-oxo-2-[(2S)-5-oxopyrrolidin-2-yl]acetyl]amino]-28-propan-2-yl-3,5,7,11,14,19,22,25-octazapentacyclo[16.13.2.12,29.15,8.04,32]pentatriaconta-1,4(32),6,8(35),29(34),30-hexaene-10-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid
Internal ID | 5af29f4d-2d53-461c-bd19-b9b4b0970f9e |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 2-[[(10S,16S,21S,24S,27S,28R)-21-butan-2-yl-16-[3-(diaminomethylideneamino)propyl]-24-(2-methylpropyl)-12,15,17,20,23,26-hexaoxo-27-[[2-oxo-2-[(2S)-5-oxopyrrolidin-2-yl]acetyl]amino]-28-propan-2-yl-3,5,7,11,14,19,22,25-octazapentacyclo[16.13.2.12,29.15,8.04,32]pentatriaconta-1,4(32),6,8(35),29(34),30-hexaene-10-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
SMILES (Canonical) | CCC(C)C1C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)NC(C(=O)N1)CC(C)C)NC(=O)C(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)CNC(=O)C(C2=O)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)N=C6 |
SMILES (Isomeric) | CCC(C)[C@H]1C(=O)NC2CC3=C(NC4=C3C=CC(=C4)[C@H]([C@@H](C(=O)N[C@H](C(=O)N1)CC(C)C)NC(=O)C(=O)[C@@H]5CCC(=O)N5)C(C)C)N6C=C(C[C@H](NC(=O)CNC(=O)[C@H](C2=O)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)N=C6 |
InChI | InChI=1S/C55H79N17O12/c1-7-27(6)42-50(80)68-36-21-32-30-13-12-28(41(26(4)5)43(51(81)69-37(18-25(2)3)49(79)70-42)71-52(82)45(76)33-14-15-39(73)64-33)19-35(30)66-46(32)72-23-29(63-24-72)20-38(48(78)67-34(53(83)84)11-9-17-61-55(58)59)65-40(74)22-62-47(77)31(44(36)75)10-8-16-60-54(56)57/h12-13,19,23-27,31,33-34,36-38,41-43,66H,7-11,14-18,20-22H2,1-6H3,(H,62,77)(H,64,73)(H,65,74)(H,67,78)(H,68,80)(H,69,81)(H,70,79)(H,71,82)(H,83,84)(H4,56,57,60)(H4,58,59,61)/t27?,31-,33-,34?,36?,37-,38-,41+,42-,43-/m0/s1 |
InChI Key | GFHQCPHHKVUYTN-DBAAUTEZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H79N17O12 |
Molecular Weight | 1170.30 g/mol |
Exact Mass | 1169.60941102 g/mol |
Topological Polar Surface Area (TPSA) | 467.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
![2D Structure of 2-[[(10S,16S,21S,24S,27S,28R)-21-butan-2-yl-16-[3-(diaminomethylideneamino)propyl]-24-(2-methylpropyl)-12,15,17,20,23,26-hexaoxo-27-[[2-oxo-2-[(2S)-5-oxopyrrolidin-2-yl]acetyl]amino]-28-propan-2-yl-3,5,7,11,14,19,22,25-octazapentacyclo[16.13.2.12,29.15,8.04,32]pentatriaconta-1,4(32),6,8(35),29(34),30-hexaene-10-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid 2D Structure of 2-[[(10S,16S,21S,24S,27S,28R)-21-butan-2-yl-16-[3-(diaminomethylideneamino)propyl]-24-(2-methylpropyl)-12,15,17,20,23,26-hexaoxo-27-[[2-oxo-2-[(2S)-5-oxopyrrolidin-2-yl]acetyl]amino]-28-propan-2-yl-3,5,7,11,14,19,22,25-octazapentacyclo[16.13.2.12,29.15,8.04,32]pentatriaconta-1,4(32),6,8(35),29(34),30-hexaene-10-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/05fa7c70-85bc-11ee-a49d-dd8e4dfb8cfa.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.98% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.82% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.67% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.51% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.34% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.03% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.67% | 90.71% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 95.64% | 90.24% |
CHEMBL2535 | P11166 | Glucose transporter | 95.62% | 98.75% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.55% | 90.08% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.44% | 94.75% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.51% | 93.56% |
CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 94.08% | 88.33% |
CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 93.60% | 94.36% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.31% | 93.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.25% | 95.89% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 92.07% | 98.59% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.77% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.70% | 93.99% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.07% | 88.56% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.45% | 97.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.89% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.83% | 96.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.50% | 97.64% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 87.07% | 99.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.21% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.07% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.76% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.43% | 99.23% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.74% | 97.50% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 83.67% | 97.00% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.18% | 82.86% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.97% | 85.83% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.25% | 93.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.99% | 91.49% |
CHEMBL2443 | P49862 | Kallikrein 7 | 80.98% | 94.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.81% | 96.90% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.13% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
PubChem | 101236344 |
LOTUS | LTS0085263 |
wikiData | Q105007552 |