[5-ethenyl-1-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 6782281a-200e-4608-9ec6-9dffa40ccc6a |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [5-ethenyl-1-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C=CC1C2CC(OC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C=CC4=CC(=C(C=C4)O)O |
SMILES (Isomeric) | C=CC1C2CC(OC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C=CC4=CC(=C(C=C4)O)O |
InChI | InChI=1S/C25H28O13/c1-2-12-13-8-19(36-18(29)6-4-11-3-5-15(27)16(28)7-11)37-23(33)14(13)10-34-24(12)38-25-22(32)21(31)20(30)17(9-26)35-25/h2-7,10,12-13,17,19-22,24-28,30-32H,1,8-9H2 |
InChI Key | JZAJSJKWOPTXFR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O13 |
Molecular Weight | 536.50 g/mol |
Exact Mass | 536.15299094 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
![2D Structure of [5-ethenyl-1-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [5-ethenyl-1-oxo-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/05ee7390-85ca-11ee-80e4-39b471a8a820.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.88% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.21% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 97.12% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.72% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.41% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.75% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.71% | 95.93% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.57% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.66% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.36% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.11% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.68% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.31% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.10% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bhesa paniculata |
PubChem | 85104488 |
LOTUS | LTS0244894 |
wikiData | Q105137319 |