(1S,4S,9R,12S,13R,16R,17R)-17-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadec-5-en-7-one
Internal ID | 9cc55ff0-a6ae-41e6-a649-4160b681aaf7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | (1S,4S,9R,12S,13R,16R,17R)-17-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadec-5-en-7-one |
SMILES (Canonical) | CC12CCC3C(=CC(=O)O3)C1CCC45C2CCC(C4)C(C5)(CO)OC6C(C(C(C(O6)COC7C(C(CO7)(CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@]12CC[C@@H]3C(=CC(=O)O3)[C@H]1CC[C@]45[C@H]2CC[C@H](C4)[C@](C5)(CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@](CO7)(CO)O)O)O)O)O |
InChI | InChI=1S/C31H46O13/c1-28-6-5-18-16(8-21(34)42-18)17(28)4-7-29-9-15(2-3-20(28)29)31(11-29,13-33)44-26-24(37)23(36)22(35)19(43-26)10-40-27-25(38)30(39,12-32)14-41-27/h8,15,17-20,22-27,32-33,35-39H,2-7,9-14H2,1H3/t15-,17-,18-,19-,20+,22-,23+,24-,25+,26+,27-,28-,29+,30-,31+/m1/s1 |
InChI Key | IRNYTXGZROFQNV-AKPRCOCFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H46O13 |
Molecular Weight | 626.70 g/mol |
Exact Mass | 626.29384152 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of (1S,4S,9R,12S,13R,16R,17R)-17-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadec-5-en-7-one 2D Structure of (1S,4S,9R,12S,13R,16R,17R)-17-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadec-5-en-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/049ccd50-85a7-11ee-b052-95ac58f6c8e0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 97.40% | 96.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.72% | 97.09% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.34% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.26% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.91% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.89% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.79% | 94.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.26% | 94.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.04% | 90.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.55% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.53% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.48% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.32% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.25% | 94.75% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 84.55% | 97.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.22% | 94.45% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.21% | 93.18% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.10% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.77% | 95.83% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.73% | 86.92% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.54% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 81.54% | 98.95% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.44% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.37% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.26% | 97.25% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.30% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.15% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diplospora dubia |
PubChem | 20056361 |
LOTUS | LTS0041801 |
wikiData | Q105118987 |