1-[3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-1,6-dimethoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone
Internal ID | c38c7bd3-98f0-4325-b6ff-1b7c4b7bc1b4 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-[3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-1,6-dimethoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
SMILES (Canonical) | CC(=O)C1=C(C2=C(C=C(C=C2C=C1OC3C(C(CO3)(CO)O)O)OC)OC4C(C(C(C(O4)CO)O)O)O)OC |
SMILES (Isomeric) | CC(=O)C1=C(C2=C(C=C(C=C2C=C1O[C@@H]3[C@H]([C@@](CO3)(CO)O)O)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC |
InChI | InChI=1S/C25H32O14/c1-10(28)16-13(38-24-22(32)25(33,8-27)9-36-24)5-11-4-12(34-2)6-14(17(11)21(16)35-3)37-23-20(31)19(30)18(29)15(7-26)39-23/h4-6,15,18-20,22-24,26-27,29-33H,7-9H2,1-3H3/t15-,18-,19+,20-,22-,23-,24-,25+/m1/s1 |
InChI Key | PGDDDJBSORSPAG-NCAJNNROSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H32O14 |
Molecular Weight | 556.50 g/mol |
Exact Mass | 556.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | -1.20 |
BDBM50133040 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2409 | P34913 | Epoxide hydratase |
600 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.79% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.15% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.46% | 94.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.31% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.04% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.84% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.60% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.54% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.90% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.72% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.07% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.62% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.55% | 91.24% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.06% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.98% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.46% | 92.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.42% | 97.21% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.77% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.70% | 85.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.43% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senna tora |
PubChem | 122196301 |
LOTUS | LTS0017297 |
wikiData | Q105208323 |